{{drugbox | verifiedrevid = 459522522 | IUPAC_name = (2R,4S)-rel-1-(butan-2-il)-4-{4-[4-(4-{[(2R,4S)-2-(2,4-diklorofenil)-2-
(1H-1,2,4-triazol-1-ilmetil)-1,3-dioksolan-
4-yl]metoksi}fenil)piperazin-1-il]fenil}-4,5-dihidro-1H-1,2,4-triazol-5-on | image = Itraconazole2DACS.svg | width = 300px | imagename = Campuran 1 : 1 (rasemat) | drug_name = Itrakonazol

| tradename = Sporanox | Drugs.com = Monograph | MedlinePlus = a692049 | pregnancy_AU = B3 | pregnancy_US = C | legal_AU = S4 | legal_CA = Rx-sahaja | legal_UK = POM | legal_US = Rx-sahaja | routes_of_administration = Mulut dan i.v. (AS), Mulut sahaja (UK)

| bioavailability = 55%, maksimum sekiranya diambil dengan hidangan lengkap | protein_bound = 99.8% | metabolism = hepatik (CYP3A4) | elimination_half-life = 21 jam | excretion = Air kencing, tinja

| CASNo_Ref =  Yes check.svgY | CAS_number_Ref =  Yes check.svgY | CAS_number = 84625-61-6 | ATC_prefix = J02 | ATC_suffix = AC02 | PubChem = 55283 | DrugBank_Ref =  Yes check.svgY

| DrugBank = DB01167

| ChemSpiderID_Ref =  Yes check.svgY | ChemSpiderID = 49927 | UNII_Ref = Templat:Fdacite | UNII = 304NUG5GF4 | KEGG_Ref =  Yes check.svgY | KEGG = D00350 | ChEBI_Ref =  Yes check.svgY | ChEBI = 6076 | ChEMBL_Ref =  Yes check.svgY | ChEMBL = 22587

| C=35 | H=38 | Cl=2 | N=8 | O=4 | molecular_weight = 705.64 | smiles = O=C1N(/N=C\N1c2ccc(cc2)N7CCN(c6ccc(OC[C@@H]3O[C@](OC3)(c4ccc(Cl)cc4Cl)Cn5ncnc5)cc6)CC7)C(C)CC | InChI = 1/C35H38Cl2N8O4/c1-3-25(2)45-34(46)44(24-40-45)29-7-5-27(6-8-29)41-14-16-42(17-15-41)28-9-11-30(12-10-28)47-19-31-20-48-35(49-31,21-43-23-38-22-39-43)32-13-4-26(36)18-33(32)37/h4-13,18,22-25,31H,3,14-17,19-21H2,1-2H3/t25?,31-,35-/m0/s1 | InChIKey = VHVPQPYKVGDNFY-ZPGVKDDIBW | StdInChI_Ref =  Yes check.svgY | StdInChI = 1S/C35H38Cl2N8O4/c1-3-25(2)45-34(46)44(24-40-45)29-7-5-27(6-8-29)41-14-16-42(17-15-41)28-9-11-30(12-10-28)47-19-31-20-48-35(49-31,21-43-23-38-22-39-43)32-13-4-26(36)18-33(32)37/h4-13,18,22-25,31H,3,14-17,19-21H2,1-2H3/t25?,31-,35-/m0/s1 | StdInChIKey_Ref =  Yes check.svgY | StdInChIKey = VHVPQPYKVGDNFY-ZPGVKDDISA-N }} Itrakonazol (R51211), dicipta pada 1984, ialah agen antikulat triazola dipreskripsi kepada pesakit dengan jangkitan kulat. Ubat ini boleh diberikan melalui mulut atau melalui intravena.

Lihat jugaSunting

Nota kakiSunting

Pautan luarSunting

Templat:Antikulat Templat:Piperazina