Siklosporin: Perbezaan antara semakan
Kandungan dihapus Kandungan ditambah
Pengemasan. Teg-teg: Suntingan mudah alih Suntingan web mudah alih |
Menambah kotak info. |
||
Baris 1:
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 459588806
| IUPAC_name = (3''S'',6''S'',9''S'',12''R'',15''S'',18''S'',21''S'',24''S'',30''S'',33''S'')-30-Ethyl-33-[(1''R'',2''R'',4''E'')-1-hydroxy-2-methyl-4-hexen-1-yl]-6,9,18,24-tetraisobutyl-3,21-diisopropyl-1,4,7,10,12,15,19,25,28-nonamethyl-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
| image = Ciclosporin.svg
| width = 250
| image2 = Ciclosporin-A-neutron-3D-sticks.png
| width2 = 250
| drug_name =
<!--Clinical data-->
| pronounce = {{IPAc-en|ˌ|s|aɪ|k|l|ə|ˈ|s|p|ɔr|ɪ|n}}<ref>{{cite web|url=http://dictionary.reference.com/browse/cyclosporin|title=cyclosporin|work=Dictionary.com Unabridged|publisher=[[Random House]]|date=n.d.|accessdate=2011-07-13|deadurl=no|archiveurl=https://web.archive.org/web/20101118062350/http://dictionary.reference.com/browse/cyclosporin|archivedate=2010-11-18|df=}}</ref>
| tradename = Neoral, Sandimmune, others
| USAN=cyclosporine
| synonyms = cyclosporin, ciclosporin A,<ref>{{cite journal | vauthors = Laupacis A, Keown PA, Ulan RA, McKenzie N, Stiller CR | title = Cyclosporin A: a powerful immunosuppressant | journal = Canadian Medical Association Journal | volume = 126 | issue = 9 | pages = 1041–6 | date = May 1982 | pmid = 7074504 | pmc = 1863293 }}</ref> cyclosporine A, cyclosporin A (CsA)
| Drugs.com = {{drugs.com|monograph|cyclosporine}}
| MedlinePlus = a601207
| pregnancy_AU = C
| pregnancy_US = C
| pregnancy_category =
| licence_EU = yes
| legal_AU = S4
| legal_UK = POM
| legal_US = Rx-only
| legal_status =
| routes_of_administration = By mouth, [[intravenous|IV]], eye drops
| class = [[immunosuppressant]]<!--Per ATC code prefix L04A--><br />[[calcineurin inhibitor]]<!--Per ATC code prefix L04AD--><br />[[Ophthalmology|eye medication]]<!--Per ATC code prefix S01XA-->
<!--Pharmacokinetic data-->
| bioavailability = Variable
| metabolism = [[liver]] [[CYP3A4]]
| elimination_half-life = Variable (about 24 hours)
| excretion = [[Bile|biliary]]
<!--Identifiers-->
| IUPHAR_ligand = 1024
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 59865-13-3
| ATC_prefix = L04
| ATC_suffix = AD01
| ATC_supplemental = {{ATC|S01|XA18}}
| PubChem = 5284373
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB00091
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4447449
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 83HN0GTJ6D
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00184
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 160
<!--Chemical data-->
| C=62 | H=111
| N=11 | O=12
| molecular_weight = 1202.61 g/mol
| smiles = CC[C@H]1C(=O)N(CC(=O)N([C@H](C(=O)N[C@H](C(=O)N([C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N1)[C@@H]([C@H](C)C/C=C/C)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C62H111N11O12/c1-25-27-28-40(15)52(75)51-56(79)65-43(26-2)58(81)67(18)33-48(74)68(19)44(29-34(3)4)55(78)66-49(38(11)12)61(84)69(20)45(30-35(5)6)54(77)63-41(16)53(76)64-42(17)57(80)70(21)46(31-36(7)8)59(82)71(22)47(32-37(9)10)60(83)72(23)50(39(13)14)62(85)73(51)24/h25,27,34-47,49-52,75H,26,28-33H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78)/b27-25+/t40-,41+,42-,43+,44+,45+,46+,47+,49+,50+,51+,52-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PMATZTZNYRCHOR-CGLBZJNRSA-N
}}
'''Siklosporina''', juga disebut '''siklosporin''', merupakan ubat imunosuppresan dan produk asli.<ref name="WHO2008">{{Cite book|url=http://apps.who.int/medicinedocs/documents/s16879e/s16879e.pdf|title=WHO Model Formulary 2008|date=2009|publisher=World Health Organization|isbn=9789241547659|page=221|access-date=8 December 2016|archive-url=https://web.archive.org/web/20161213060118/http://apps.who.int/medicinedocs/documents/s16879e/s16879e.pdf|archive-date=13 December 2016|dead-url=no}}</ref> Ia diambil melalui mulut atau oleh [[Terapi dalam vena|suntikan dalam pembuluh darah]] untuk [[artritis reumatoid]], [[psoriasis]], penyakit Crohn, sindrom nefrotik, dan [[pemindahan organ|transplantasi organ]] untuk mencegah penolakan.<ref name="AHFS2016">{{Cite web|url=https://www.drugs.com/monograph/cyclosporine.html|title=Cyclosporine|publisher=The American Society of Health-System Pharmacists|archive-url=https://web.archive.org/web/20161017140204/https://www.drugs.com/monograph/cyclosporine.html|archive-date=17 October 2016|dead-url=no|access-date=8 December 2016}}</ref> Ia juga digunakan sebagai ubat penitis mata untuk keratoconjunctivitis sicca (mata kering).<ref name="AHFS2016B">{{Cite web|url=https://www.drugs.com/monograph/cyclosporine-eent.html|title=Cyclosporine eent|publisher=The American Society of Health-System Pharmacists|archive-url=https://web.archive.org/web/20160113234854/http://www.drugs.com/monograph/cyclosporine-eent.html|archive-date=13 January 2016|dead-url=no|access-date=8 December 2016}}</ref>
Baris 5 ⟶ 66:
== Pautan luar ==
* [https://druginfo.nlm.nih.gov/drugportal/rn/79217-60-0 Perpustakaan Negara AS Perubatan: Maklumat Dadah Portal — Cyclosporine]
* [http://chemsub.online.fr/name/cyclosporin_a.html ChemSub Online<span> </span>: Cyclosporin Satu]
Baris 12 ⟶ 71:
* [http://www.restasis.com/ Restasis jenama]
* [http://www.pharma.us.novartis.com/product/pi/pdf/sandimmune.pdf Sandimmune AS Menetapkan Maklumat]
[[Kategori:Bahan kimia]]
| |||